Clorambucile: differenze tra le versioni

Da Wikipedia, l'enciclopedia libera.
Vai alla navigazione Vai alla ricerca
Naviga nella cronologia in modo interattivo
← Differenza precedenteDifferenza successiva →
Contenuto cancellato Contenuto aggiunto
VisualeWikitesto
AlessioBot (discussione | contributi)
329 744 modifiche
m →‎Collegamenti esterni: Fix livello sezione Collegamenti esterni
Atarubot (discussione | contributi)
550 442 modifiche
template citazione; elimino parametri vuoti; fix parametro pmid; fix parametro isbn
Riga 41: Riga 41:
Come tutti gli agenti alchilanti, determina alterazioni nella sintesi e duplicazione degli acidi nucleici (DNA), determinando la morte cellulare delle stesse cellule per [[apoptosi]] dovuta alle estese lesioni [[nucleo cellulare|nucleari]] determinate.
Come tutti gli agenti alchilanti, determina alterazioni nella sintesi e duplicazione degli acidi nucleici (DNA), determinando la morte cellulare delle stesse cellule per [[apoptosi]] dovuta alle estese lesioni [[nucleo cellulare|nucleari]] determinate.


In Italia è commercializzato da parte della [[GSK]] con il marchio: ''Leukeran''<ref name="urlLeukeran 2mg">{{Cita web | url = http://www.torrinomedica.it/farmaci/schedetecniche/Leukeran_2mg.asp | titolo = Leukeran 2mg | autore = | wkautore = | coautori = | data = | formato = | opera = | editore = | pagine = | lingua = | urlarchivio = | dataarchivio = | citazione = | accesso=11 agosto 2010}}</ref>; il marchio è lo stesso in tutto il mondo.
In Italia è commercializzato da parte della [[GSK]] con il marchio: ''Leukeran''<ref name="urlLeukeran 2mg">{{Cita web | url = http://www.torrinomedica.it/farmaci/schedetecniche/Leukeran_2mg.asp | titolo = Leukeran 2mg | autore = | data = | accesso=11 agosto 2010}}</ref>; il marchio è lo stesso in tutto il mondo.


== Reattività e caratteristiche chimiche ==
== Reattività e caratteristiche chimiche ==
Riga 53: Riga 53:
{{Vedi anche|Off-label}}
{{Vedi anche|Off-label}}
Viene anche utilizzato in caso di:
Viene anche utilizzato in caso di:
* [[dermatomiosite]]<ref>{{Cita pubblicazione | cognome = Choy | nome = EH. | coautori = JE. Hoogendijk; B. Lecky; JB. Winer; P. Gordon | titolo = WITHDRAWN: Immunosuppressant and immunomodulatory treatment for dermatomyositis and polymyositis. | rivista = Cochrane Database Syst Rev | volume = | numero = 4 | pagine = CD003643 | mese = | anno = 2009 | doi = 10.1002/14651858.CD003643.pub3 | id = PMID 19821312 }}</ref><ref>{{Cita pubblicazione | cognome = Choy | nome = EH. | coautori = JE. Hoogendijk; B. Lecky; JB. Winer | titolo = Immunosuppressant and immunomodulatory treatment for dermatomyositis and polymyositis. | rivista = Cochrane Database Syst Rev | volume = | numero = 3 | pagine = CD003643 | mese = | anno = 2005 | doi = 10.1002/14651858.CD003643.pub2 | id = PMID 16034905 }}</ref><ref>{{Cita pubblicazione | cognome = Cherin | nome = P. | coautori = S. Pelletier; A. Teixeira; P. Laforet; T. Genereau; A. Simon; T. Maisonobe; B. Eymard; S. Herson | titolo = Results and long-term followup of intravenous immunoglobulin infusions in chronic, refractory polymyositis: an open study with thirty-five adult patients. | rivista = Arthritis Rheum | volume = 46 | numero = 2 | pagine = 467-74 | mese=febbraio| anno = 2002 | doi = | id = PMID 11840450 }}</ref><ref>{{Cita pubblicazione | cognome = Whallett | nome = AJ. | coautori = TJ. Gillott; R. Klocke; JS. Coppock | titolo = A case of refractory adult dermatomyositis. | rivista = Br J Rheumatol | volume = 37 | numero = 5 | pagine = 544-5 | mese=maggio| anno = 1998 | doi = | id = PMID 9651083 }}</ref>,
* [[dermatomiosite]]<ref>{{Cita pubblicazione | cognome = Choy | nome = EH. | coautori = JE. Hoogendijk; B. Lecky; JB. Winer; P. Gordon | titolo = WITHDRAWN: Immunosuppressant and immunomodulatory treatment for dermatomyositis and polymyositis. | rivista = Cochrane Database Syst Rev | numero = 4 | pagine = CD003643 | anno = 2009 | doi = 10.1002/14651858.CD003643.pub3 | pmid = 19821312 }}</ref><ref>{{Cita pubblicazione | cognome = Choy | nome = EH. | coautori = JE. Hoogendijk; B. Lecky; JB. Winer | titolo = Immunosuppressant and immunomodulatory treatment for dermatomyositis and polymyositis. | rivista = Cochrane Database Syst Rev | numero = 3 | pagine = CD003643 | anno = 2005 | doi = 10.1002/14651858.CD003643.pub2 | pmid = 16034905 }}</ref><ref>{{Cita pubblicazione | cognome = Cherin | nome = P. | coautori = S. Pelletier; A. Teixeira; P. Laforet; T. Genereau; A. Simon; T. Maisonobe; B. Eymard; S. Herson | titolo = Results and long-term followup of intravenous immunoglobulin infusions in chronic, refractory polymyositis: an open study with thirty-five adult patients. | rivista = Arthritis Rheum | volume = 46 | numero = 2 | pagine = 467-74 | mese=febbraio| anno = 2002 | pmid = 11840450 }}</ref><ref>{{Cita pubblicazione | cognome = Whallett | nome = AJ. | coautori = TJ. Gillott; R. Klocke; JS. Coppock | titolo = A case of refractory adult dermatomyositis. | rivista = Br J Rheumatol | volume = 37 | numero = 5 | pagine = 544-5 | mese=maggio| anno = 1998 | pmid = 9651083 }}</ref>,


* [[pemfigo volgare]]<ref name="Yeh-2005">{{Cita pubblicazione | cognome = Yeh | nome = SW. | coautori = N. Sami; RA. Ahmed | titolo = Treatment of pemphigus vulgaris: current and emerging options. | rivista = Am J Clin Dermatol | volume = 6 | numero = 5 | pagine = 327-42 | mese = | anno = 2005 | doi = | id = PMID 16252932 }}</ref><ref name="Rosenkrantz-2004">{{Cita pubblicazione | cognome = Rosenkrantz | nome = WS. | coautori = | titolo = Pemphigus: current therapy. | rivista = Vet Dermatol | volume = 15 | numero = 2 | pagine = 90-8 | mese=aprile| anno = 2004 | doi = 10.1111/j.1365-3164.2004.00360.x | id = PMID 15030557 }}</ref><ref name="Shah-2000">{{Cita pubblicazione | cognome = Shah | nome = N. | coautori = AR. Green; GW. Elgart; F. Kerdel | titolo = The use of chlorambucil with prednisone in the treatment of pemphigus. | rivista = J Am Acad Dermatol | volume = 42 | numero = 1 Pt 1 | pagine = 85-8 | mese=gennaio| anno = 2000 | doi = | id = PMID 10607325 }}</ref><ref name="Cowley-1994">{{Cita pubblicazione | cognome = Cowley | nome = NC. | coautori = SM. Neill; RC. Staughton | titolo = Pemphigus foliaceus and non-Hodgkin's lymphoma. | rivista = Int J Dermatol | volume = 33 | numero = 7 | pagine = 510-1 | mese=luglio| anno = 1994 | doi = | id = PMID 7928040 }}</ref>,
* [[pemfigo volgare]]<ref name="Yeh-2005">{{Cita pubblicazione | cognome = Yeh | nome = SW. | coautori = N. Sami; RA. Ahmed | titolo = Treatment of pemphigus vulgaris: current and emerging options. | rivista = Am J Clin Dermatol | volume = 6 | numero = 5 | pagine = 327-42 | anno = 2005 | pmid = 16252932 }}</ref><ref name="Rosenkrantz-2004">{{Cita pubblicazione | cognome = Rosenkrantz | nome = WS. | titolo = Pemphigus: current therapy. | rivista = Vet Dermatol | volume = 15 | numero = 2 | pagine = 90-8 | mese=aprile| anno = 2004 | doi = 10.1111/j.1365-3164.2004.00360.x | pmid = 15030557 }}</ref><ref name="Shah-2000">{{Cita pubblicazione | cognome = Shah | nome = N. | coautori = AR. Green; GW. Elgart; F. Kerdel | titolo = The use of chlorambucil with prednisone in the treatment of pemphigus. | rivista = J Am Acad Dermatol | volume = 42 | numero = 1 Pt 1 | pagine = 85-8 | mese=gennaio| anno = 2000 | pmid = 10607325 }}</ref><ref name="Cowley-1994">{{Cita pubblicazione | cognome = Cowley | nome = NC. | coautori = SM. Neill; RC. Staughton | titolo = Pemphigus foliaceus and non-Hodgkin's lymphoma. | rivista = Int J Dermatol | volume = 33 | numero = 7 | pagine = 510-1 | mese=luglio| anno = 1994 | pmid = 7928040 }}</ref>,


* [[leucemia linfatica cronica]] <small>(Metanalisi e Linee Guida)</small><ref name="Brugiatelli-2006">{{Cita pubblicazione | cognome = Brugiatelli | nome = M. | coautori = G. Bandini; G. Barosi; F. Lauria; V. Liso; M. Marchetti; FR. Mauro; G. Meloni; PL. Zinzani; S. Tura | titolo = Management of chronic lymphocytic leukemia: practice guidelines from the Italian Society of Hematology, the Italian Society of Experimental Hematology and the Italian Group for Bone Marrow Transplantation. | rivista = Haematologica | volume = 91 | numero = 12 | pagine = 1662-73 | mese=dicembre| anno = 2006 | doi = | id = PMID 17145603 }}</ref><ref name="Steurer-2006">{{Cita pubblicazione | cognome = Steurer | nome = M. | coautori = G. Pall; S. Richards; G. Schwarzer; J. Bohlius; R. Greil | titolo = Purine antagonists for chronic lymphocytic leukaemia. | rivista = Cochrane Database Syst Rev | volume = 3 | numero = | pagine = CD004270 | mese = | anno = 2006 | doi = 10.1002/14651858.CD004270.pub2 | id = PMID 16856041 }}</ref><ref name="Atra-2002">{{Cita pubblicazione | cognome = Atra | nome = A. | coautori = E. Higgs; M. Capra; A. Elsworth; J. Imeson; M. Radford; M. Hewitt | titolo = ChlVPP chemotherapy in children with stage IV Hodgkin's disease: results of the UKCCSG HD 8201 and HD 9201 studies. | rivista = Br J Haematol | volume = 119 | numero = 3 | pagine = 647-51 | mese=dicembre| anno = 2002 | doi = | id = PMID 12437639 }}</ref><ref name="-1999">{{Cita pubblicazione | cognome = | nome = | coautori = | titolo = Chemotherapeutic options in chronic lymphocytic leukemia: a meta-analysis of the randomized trials. CLL Trialists' Collaborative Group. | rivista = J Natl Cancer Inst | volume = 91 | numero = 10 | pagine = 861-8 | mese=maggio| anno = 1999 | doi = | id = PMID 10340906 }}</ref>,
* [[leucemia linfatica cronica]] <small>(Metanalisi e Linee Guida)</small><ref name="Brugiatelli-2006">{{Cita pubblicazione | cognome = Brugiatelli | nome = M. | coautori = G. Bandini; G. Barosi; F. Lauria; V. Liso; M. Marchetti; FR. Mauro; G. Meloni; PL. Zinzani; S. Tura | titolo = Management of chronic lymphocytic leukemia: practice guidelines from the Italian Society of Hematology, the Italian Society of Experimental Hematology and the Italian Group for Bone Marrow Transplantation. | rivista = Haematologica | volume = 91 | numero = 12 | pagine = 1662-73 | mese=dicembre| anno = 2006 | pmid = 17145603 }}</ref><ref name="Steurer-2006">{{Cita pubblicazione | cognome = Steurer | nome = M. | coautori = G. Pall; S. Richards; G. Schwarzer; J. Bohlius; R. Greil | titolo = Purine antagonists for chronic lymphocytic leukaemia. | rivista = Cochrane Database Syst Rev | volume = 3 | pagine = CD004270 | anno = 2006 | doi = 10.1002/14651858.CD004270.pub2 | pmid = 16856041 }}</ref><ref name="Atra-2002">{{Cita pubblicazione | cognome = Atra | nome = A. | coautori = E. Higgs; M. Capra; A. Elsworth; J. Imeson; M. Radford; M. Hewitt | titolo = ChlVPP chemotherapy in children with stage IV Hodgkin's disease: results of the UKCCSG HD 8201 and HD 9201 studies. | rivista = Br J Haematol | volume = 119 | numero = 3 | pagine = 647-51 | mese=dicembre| anno = 2002 | pmid = 12437639 }}</ref><ref name="-1999">{{Cita pubblicazione | cognome = | nome = | titolo = Chemotherapeutic options in chronic lymphocytic leukemia: a meta-analysis of the randomized trials. CLL Trialists' Collaborative Group. | rivista = J Natl Cancer Inst | volume = 91 | numero = 10 | pagine = 861-8 | mese=maggio| anno = 1999 | pmid =10340906}}</ref>,


* [[istiocitosi X]]<ref name="Miot-Noirault-2009">{{Cita pubblicazione | cognome = Miot-Noirault | nome = E. | coautori = B. Reux; E. Debiton; JC. Madelmont; JM. Chezal; P. Coudert; V. Weber | titolo = Preclinical investigation of tolerance and antitumour activity of new fluorodeoxyglucose-coupled chlorambucil alkylating agents. | rivista = Invest New Drugs | volume = | numero = | pagine = | mese=dicembre| anno = 2009 | doi = 10.1007/s10637-009-9371-0 | id = PMID 20033262 }}</ref><ref name="Doherty-2008">{{Cita pubblicazione | cognome = Doherty | nome = CB. | coautori = T. Rosen | titolo = Evidence-based therapy for cutaneous sarcoidosis. | rivista = Drugs | volume = 68 | numero = 10 | pagine = 1361-83 | mese = | anno = 2008 | doi = | id = PMID 18578557 }}</ref>,
* [[istiocitosi X]]<ref name="Miot-Noirault-2009">{{Cita pubblicazione | cognome = Miot-Noirault | nome = E. | coautori = B. Reux; E. Debiton; JC. Madelmont; JM. Chezal; P. Coudert; V. Weber | titolo = Preclinical investigation of tolerance and antitumour activity of new fluorodeoxyglucose-coupled chlorambucil alkylating agents. | rivista = Invest New Drugs | mese=dicembre| anno = 2009 | doi = 10.1007/s10637-009-9371-0 | pmid = 20033262 }}</ref><ref name="Doherty-2008">{{Cita pubblicazione | cognome = Doherty | nome = CB. | coautori = T. Rosen | titolo = Evidence-based therapy for cutaneous sarcoidosis. | rivista = Drugs | volume = 68 | numero = 10 | pagine = 1361-83 | anno = 2008 | pmid = 18578557 }}</ref>,


* [[mastocitosi]],
* [[mastocitosi]],
* [[linfoma di Hodgkin]]<ref name="Zinzani-2008">{{Cita pubblicazione | cognome = Zinzani | nome = PL. | coautori = M. Martelli; V. Poletti; U. Vitolo; PG. Gobbi; T. Chisesi; G. Barosi; AJ. Ferreri; M. Marchetti; N. Pimpinelli; S. Tura | titolo = Practice guidelines for the management of extranodal non-Hodgkin's lymphomas of adult non-immunodeficient patients. Part I: primary lung and mediastinal lymphomas. A project of the Italian Society of Hematology, the Italian Society of Experimental Hematology and the Italian Group for Bone Marrow Transplantation. | rivista = Haematologica | volume = 93 | numero = 9 | pagine = 1364-71 | mese=settembre| anno = 2008 | doi = 10.3324/haematol.12742 | id = PMID 18603558 }}</ref><ref name="Yadav-">{{Cita pubblicazione | cognome = Yadav | nome = BS. | coautori = SC. Sharma; RK. Kapoor | titolo = Paraneoplastic leukocytoclastic vasculitis in chronic lymphoid leukemia. | rivista = J Cancer Res Ther | volume = 2 | numero = 4 | pagine = 206-8 | mese = | anno = | doi = | id = PMID 17998707 }}</ref><ref name="van Agthoven-2005">{{Cita pubblicazione | cognome = van Agthoven | nome = M. | coautori = MH. Kramer; P. Sonneveld; KG. van der Hem; PC. Huijgens; PW. Wijermans; HC. Kluin-Nelemans; MR. Schaafsma; DH. Biesma; V. Mattijssen; CA. Uyl-de Groot | titolo = Cost analysis of common treatment options for indolent follicular non-Hodgkin's lymphoma. | rivista = Haematologica | volume = 90 | numero = 10 | pagine = 1422-32 | mese=ottobre| anno = 2005 | doi = | id = PMID 16219580 }}</ref><ref name="Sieber-2004">{{Cita pubblicazione | cognome = Sieber | nome = M. | coautori = H. Tesch; B. Pfistner; U. Rueffer; U. Paulus; R. Munker; R. Hermann; G. Doelken; P. Koch; J. Oertel; S. Roller | titolo = Treatment of advanced Hodgkin's disease with COPP/ABV/IMEP versus COPP/ABVD and consolidating radiotherapy: final results of the German Hodgkin's Lymphoma Study Group HD6 trial. | rivista = Ann Oncol | volume = 15 | numero = 2 | pagine = 276-82 | mese=febbraio| anno = 2004 | doi = | id = PMID 14760122 }}</ref><ref name="Metayer-2003">{{Cita pubblicazione | cognome = Metayer | nome = C. | coautori = RE. Curtis; J. Vose; KA. Sobocinski; MM. Horowitz; S. Bhatia; JW. Fay; CO. Freytes; SC. Goldstein; RH. Herzig; A. Keating | titolo = Myelodysplastic syndrome and acute myeloid leukemia after autotransplantation for lymphoma: a multicenter case-control study. | rivista = Blood | volume = 101 | numero = 5 | pagine = 2015-23 | mese=marzo| anno = 2003 | doi = 10.1182/blood-2002-04-1261 | id = PMID 12393427 }}</ref><ref name="Witzig-2000">{{Cita pubblicazione | cognome = Witzig | nome = TE. | coautori = M. Timm; M. Stenson; PA. Svingen; SH. Kaufmann | titolo = Induction of apoptosis in malignant B cells by phenylbutyrate or phenylacetate in combination with chemotherapeutic agents. | rivista = Clin Cancer Res | volume = 6 | numero = 2 | pagine = 681-92 | mese=febbraio| anno = 2000 | doi = | id = PMID 10690554 }}</ref>,
* [[linfoma di Hodgkin]]<ref name="Zinzani-2008">{{Cita pubblicazione | cognome = Zinzani | nome = PL. | coautori = M. Martelli; V. Poletti; U. Vitolo; PG. Gobbi; T. Chisesi; G. Barosi; AJ. Ferreri; M. Marchetti; N. Pimpinelli; S. Tura | titolo = Practice guidelines for the management of extranodal non-Hodgkin's lymphomas of adult non-immunodeficient patients. Part I: primary lung and mediastinal lymphomas. A project of the Italian Society of Hematology, the Italian Society of Experimental Hematology and the Italian Group for Bone Marrow Transplantation. | rivista = Haematologica | volume = 93 | numero = 9 | pagine = 1364-71 | mese=settembre| anno = 2008 | doi = 10.3324/haematol.12742 | pmid = 18603558 }}</ref><ref name="Yadav-">{{Cita pubblicazione | cognome = Yadav | nome = BS. | coautori = SC. Sharma; RK. Kapoor | titolo = Paraneoplastic leukocytoclastic vasculitis in chronic lymphoid leukemia. | rivista = J Cancer Res Ther | volume = 2 | numero = 4 | pagine = 206-8 | pmid = 17998707 }}</ref><ref name="van Agthoven-2005">{{Cita pubblicazione | cognome = van Agthoven | nome = M. | coautori = MH. Kramer; P. Sonneveld; KG. van der Hem; PC. Huijgens; PW. Wijermans; HC. Kluin-Nelemans; MR. Schaafsma; DH. Biesma; V. Mattijssen; CA. Uyl-de Groot | titolo = Cost analysis of common treatment options for indolent follicular non-Hodgkin's lymphoma. | rivista = Haematologica | volume = 90 | numero = 10 | pagine = 1422-32 | mese=ottobre| anno = 2005 | pmid = 16219580 }}</ref><ref name="Sieber-2004">{{Cita pubblicazione | cognome = Sieber | nome = M. | coautori = H. Tesch; B. Pfistner; U. Rueffer; U. Paulus; R. Munker; R. Hermann; G. Doelken; P. Koch; J. Oertel; S. Roller | titolo = Treatment of advanced Hodgkin's disease with COPP/ABV/IMEP versus COPP/ABVD and consolidating radiotherapy: final results of the German Hodgkin's Lymphoma Study Group HD6 trial. | rivista = Ann Oncol | volume = 15 | numero = 2 | pagine = 276-82 | mese=febbraio| anno = 2004 | pmid = 14760122 }}</ref><ref name="Metayer-2003">{{Cita pubblicazione | cognome = Metayer | nome = C. | coautori = RE. Curtis; J. Vose; KA. Sobocinski; MM. Horowitz; S. Bhatia; JW. Fay; CO. Freytes; SC. Goldstein; RH. Herzig; A. Keating | titolo = Myelodysplastic syndrome and acute myeloid leukemia after autotransplantation for lymphoma: a multicenter case-control study. | rivista = Blood | volume = 101 | numero = 5 | pagine = 2015-23 | mese=marzo| anno = 2003 | doi = 10.1182/blood-2002-04-1261 | pmid = 12393427 }}</ref><ref name="Witzig-2000">{{Cita pubblicazione | cognome = Witzig | nome = TE. | coautori = M. Timm; M. Stenson; PA. Svingen; SH. Kaufmann | titolo = Induction of apoptosis in malignant B cells by phenylbutyrate or phenylacetate in combination with chemotherapeutic agents. | rivista = Clin Cancer Res | volume = 6 | numero = 2 | pagine = 681-92 | mese=febbraio| anno = 2000 | pmid = 10690554 }}</ref>,


* [[linfosarcoma]],
* [[linfosarcoma]],
* [[malattia di Behcet]] ([[uveite]])<ref name="Zaghetto-2010">{{Cita pubblicazione | cognome = Zaghetto | nome = JM. | coautori = MM. Yamamoto; MB. Souza; FT. Silva; CE. Hirata; E. Olivalves; JH. Yamamoto | titolo = Chlorambucil and cyclosporine A in Brazilian patients with Behçet's disease uveitis: a retrospective study. | rivista = Arq Bras Oftalmol | volume = 73 | numero = 1 | pagine = 40-6 | mese=febbraio| anno = 2010 | doi = | id = PMID 20464112 }}</ref><ref name="Borhani Haghighi-2009">{{Cita pubblicazione | cognome = Borhani Haghighi | nome = A. | coautori = | titolo = Treatment of neuro-Behçet's disease: an update. | rivista = Expert Rev Neurother | volume = 9 | numero = 4 | pagine = 565-74 | mese=aprile| anno = 2009 | doi = 10.1586/ern.09.11 | id = PMID 19344307 }}</ref><ref name="Santana-2008">{{Cita pubblicazione | cognome = Santana | nome = AN. | coautori = T. Antunes; JM. Barros; RA. Kairalla; CR. Carvalho; CS. Barbas | titolo = [Pulmonary involvement in Behcet's disease: a positive single-center experience with the use of immunosuppressive therapy] | rivista = J Bras Pneumol | volume = 34 | numero = 6 | pagine = 362-6 | mese=giugno| anno = 2008 | doi = | id = PMID 18622502 }}</ref><ref name="Vidaller Palacín-2002">{{Cita pubblicazione | cognome = Vidaller Palacín | nome = A. | coautori = J. Robert Olalla; B. Sanuy Jiménez; G. Rufi Rigau; J. Folch Civit; A. Charte González | titolo = [Behcet's disease therapy review] | rivista = An Med Interna | volume = 19 | numero = 11 | pagine = 594-8 | mese=novembre| anno = 2002 | doi = | id = PMID 12522899 }}</ref><ref name="Russell-2001">{{Cita pubblicazione | cognome = Russell | nome = AI. | coautori = WA. Lawson; DO. Haskard | titolo = Potential new therapeutic options in Behçet's syndrome. | rivista = BioDrugs | volume = 15 | numero = 1 | pagine = 25-35 | mese = | anno = 2001 | doi = | id = PMID 11437673 }}</ref>,
* [[malattia di Behcet]] ([[uveite]])<ref name="Zaghetto-2010">{{Cita pubblicazione | cognome = Zaghetto | nome = JM. | coautori = MM. Yamamoto; MB. Souza; FT. Silva; CE. Hirata; E. Olivalves; JH. Yamamoto | titolo = Chlorambucil and cyclosporine A in Brazilian patients with Behçet's disease uveitis: a retrospective study. | rivista = Arq Bras Oftalmol | volume = 73 | numero = 1 | pagine = 40-6 | mese=febbraio| anno = 2010 | pmid = 20464112 }}</ref><ref name="Borhani Haghighi-2009">{{Cita pubblicazione | cognome = Borhani Haghighi | nome = A. | titolo = Treatment of neuro-Behçet's disease: an update. | rivista = Expert Rev Neurother | volume = 9 | numero = 4 | pagine = 565-74 | mese=aprile| anno = 2009 | doi = 10.1586/ern.09.11 | pmid = 19344307 }}</ref><ref name="Santana-2008">{{Cita pubblicazione | cognome = Santana | nome = AN. | coautori = T. Antunes; JM. Barros; RA. Kairalla; CR. Carvalho; CS. Barbas | titolo = [Pulmonary involvement in Behcet's disease: a positive single-center experience with the use of immunosuppressive therapy] | rivista = J Bras Pneumol | volume = 34 | numero = 6 | pagine = 362-6 | mese=giugno| anno = 2008 | pmid = 18622502 }}</ref><ref name="Vidaller Palacín-2002">{{Cita pubblicazione | cognome = Vidaller Palacín | nome = A. | coautori = J. Robert Olalla; B. Sanuy Jiménez; G. Rufi Rigau; J. Folch Civit; A. Charte González | titolo = [Behcet's disease therapy review] | rivista = An Med Interna | volume = 19 | numero = 11 | pagine = 594-8 | mese=novembre| anno = 2002 | pmid = 12522899 }}</ref><ref name="Russell-2001">{{Cita pubblicazione | cognome = Russell | nome = AI. | coautori = WA. Lawson; DO. Haskard | titolo = Potential new therapeutic options in Behçet's syndrome. | rivista = BioDrugs | volume = 15 | numero = 1 | pagine = 25-35 | anno = 2001 | pmid = 11437673 }}</ref>,


* [[micosi]]<ref name="Dinning-1975">{{Cita pubblicazione | cognome = Dinning | nome = WJ. | coautori = ES. Perkins | titolo = Immunosuppressives in uveitis. A preliminary report of experience with chlorambucil. | rivista = Br J Ophthalmol | volume = 59 | numero = 8 | pagine = 397-403 | mese=agosto| anno = 1975 | doi = | id = PMID 1081881 }}</ref><ref name="Vavricka-2004">{{Cita pubblicazione | cognome = Vavricka | nome = SR. | coautori = J. Halter; L. Hechelhammer; A. Himmelmann | titolo = Pneumocystis carinii pneumonia in chronic lymphocytic leukaemia. | rivista = Postgrad Med J | volume = 80 | numero = 942 | pagine = 236-8 | mese=aprile| anno = 2004 | doi = | id = PMID 15082848 }}</ref><ref name="Kamran-2008">{{Cita pubblicazione | cognome = Kamran | nome = B. | coautori = M. Fatemeh; R. Ahmadreza; N. Azita | titolo = Bullous mycosis fungoides: a case report. | rivista = Dermatol Online J | volume = 14 | numero = 2 | pagine = 11 | mese = | anno = 2008 | doi = | id = PMID 18700114 }}</ref>,
* [[micosi]]<ref name="Dinning-1975">{{Cita pubblicazione | cognome = Dinning | nome = WJ. | coautori = ES. Perkins | titolo = Immunosuppressives in uveitis. A preliminary report of experience with chlorambucil. | rivista = Br J Ophthalmol | volume = 59 | numero = 8 | pagine = 397-403 | mese=agosto| anno = 1975 | pmid = 1081881 }}</ref><ref name="Vavricka-2004">{{Cita pubblicazione | cognome = Vavricka | nome = SR. | coautori = J. Halter; L. Hechelhammer; A. Himmelmann | titolo = Pneumocystis carinii pneumonia in chronic lymphocytic leukaemia. | rivista = Postgrad Med J | volume = 80 | numero = 942 | pagine = 236-8 | mese=aprile| anno = 2004 | pmid = 15082848 }}</ref><ref name="Kamran-2008">{{Cita pubblicazione | cognome = Kamran | nome = B. | coautori = M. Fatemeh; R. Ahmadreza; N. Azita | titolo = Bullous mycosis fungoides: a case report. | rivista = Dermatol Online J | volume = 14 | numero = 2 | pagine = 11 | anno = 2008 | pmid = 18700114 }}</ref>,


* [[sclerodermia]]<ref name="Marder-2007">{{Cita pubblicazione | cognome = Marder | nome = W. | coautori = WJ. McCune | titolo = Advances in immunosuppressive therapy. | rivista = Semin Respir Crit Care Med | volume = 28 | numero = 4 | pagine = 398-417 | mese=agosto| anno = 2007 | doi = 10.1055/s-2007-985612 | id = PMID 17764058 }}</ref><ref name="Wielosz-2007">{{Cita pubblicazione | cognome = Wielosz | nome = E. | coautori = M. Majdan; D. Suszek; I. Smarz-Widelska; A. Korolczuk; E. Korobowicz | titolo = Nephrotic syndrome as a clinical manifestation of systemic sclerosis. | rivista = Rheumatol Int | volume = 27 | numero = 11 | pagine = 1087-9 | mese=settembre| anno = 2007 | doi = 10.1007/s00296-007-0340-7 | id = PMID 17429639 }}</ref><ref name="Clements-1993">{{Cita pubblicazione | cognome = Clements | nome = P. | coautori = P. Lachenbruch; D. Furst; H. Paulus | titolo = The course of skin involvement in systemic sclerosis over three years in a trial of chlorambucil versus placebo. | rivista = Arthritis Rheum | volume = 36 | numero = 11 | pagine = 1575-9 | mese=novembre| anno = 1993 | doi = | id = PMID 8240434 }}</ref><ref name="Ansell-1976">{{Cita pubblicazione | cognome = Ansell | nome = BM. | coautori = GA. Nasseh; EG. Bywaters | titolo = Scleroderma in childhood. | rivista = Ann Rheum Dis | volume = 35 | numero = 3 | pagine = 189-97 | mese=giugno| anno = 1976 | doi = | id = PMID 984898 }}</ref>,
* [[sclerodermia]]<ref name="Marder-2007">{{Cita pubblicazione | cognome = Marder | nome = W. | coautori = WJ. McCune | titolo = Advances in immunosuppressive therapy. | rivista = Semin Respir Crit Care Med | volume = 28 | numero = 4 | pagine = 398-417 | mese=agosto| anno = 2007 | doi = 10.1055/s-2007-985612 | pmid = 17764058 }}</ref><ref name="Wielosz-2007">{{Cita pubblicazione | cognome = Wielosz | nome = E. | coautori = M. Majdan; D. Suszek; I. Smarz-Widelska; A. Korolczuk; E. Korobowicz | titolo = Nephrotic syndrome as a clinical manifestation of systemic sclerosis. | rivista = Rheumatol Int | volume = 27 | numero = 11 | pagine = 1087-9 | mese=settembre| anno = 2007 | doi = 10.1007/s00296-007-0340-7 | pmid = 17429639 }}</ref><ref name="Clements-1993">{{Cita pubblicazione | cognome = Clements | nome = P. | coautori = P. Lachenbruch; D. Furst; H. Paulus | titolo = The course of skin involvement in systemic sclerosis over three years in a trial of chlorambucil versus placebo. | rivista = Arthritis Rheum | volume = 36 | numero = 11 | pagine = 1575-9 | mese=novembre| anno = 1993 | pmid = 8240434 }}</ref><ref name="Ansell-1976">{{Cita pubblicazione | cognome = Ansell | nome = BM. | coautori = GA. Nasseh; EG. Bywaters | titolo = Scleroderma in childhood. | rivista = Ann Rheum Dis | volume = 35 | numero = 3 | pagine = 189-97 | mese=giugno| anno = 1976 | pmid = 984898 }}</ref>,


* [[sarcoma di Kaposi]]<ref name="Azais-1993">{{Cita pubblicazione | cognome = Azais | nome = I. | coautori = G. Lambert de Cursay; F. Deblais; O. Deschamps; P. Gandon; M. Alcalay; D. Bontoux | titolo = [Association of rheumatoid arthritis and Kaposi disease. Apropos of a case arising after intraarticular corticotherapy] | rivista = Rev Rhum Ed Fr | volume = 60 | numero = 3 | pagine = 240-4 | mese=marzo| anno = 1993 | doi = | id = PMID 8293010 }}</ref><ref name="Senanayake-2003">{{Cita pubblicazione | cognome = Senanayake | nome = S. | coautori = J. Kelly; A. Lloyd; Z. Waliuzzaman; D. Goldstein; W. Rawlinson | titolo = Multicentric Castleman's disease treated with antivirals and immunosuppressants. | rivista = J Med Virol | volume = 71 | numero = 3 | pagine = 399-403 | mese=novembre| anno = 2003 | doi = 10.1002/jmv.10500 | id = PMID 12966545 }}</ref><ref name="Koren-1985">{{Cita pubblicazione | cognome = Koren | nome = G. | coautori = E. Okon; A. Zlotnick | titolo = Coexistence of Kaposi's sarcoma and chronic lymphocytic leukemia in the same lymph node. | rivista = Acta Haematol | volume = 74 | numero = 4 | pagine = 234-5 | mese = | anno = 1985 | doi = | id = PMID 3939068 }}</ref>,
* [[sarcoma di Kaposi]]<ref name="Azais-1993">{{Cita pubblicazione | cognome = Azais | nome = I. | coautori = G. Lambert de Cursay; F. Deblais; O. Deschamps; P. Gandon; M. Alcalay; D. Bontoux | titolo = [Association of rheumatoid arthritis and Kaposi disease. Apropos of a case arising after intraarticular corticotherapy] | rivista = Rev Rhum Ed Fr | volume = 60 | numero = 3 | pagine = 240-4 | mese=marzo| anno = 1993 | pmid = 8293010 }}</ref><ref name="Senanayake-2003">{{Cita pubblicazione | cognome = Senanayake | nome = S. | coautori = J. Kelly; A. Lloyd; Z. Waliuzzaman; D. Goldstein; W. Rawlinson | titolo = Multicentric Castleman's disease treated with antivirals and immunosuppressants. | rivista = J Med Virol | volume = 71 | numero = 3 | pagine = 399-403 | mese=novembre| anno = 2003 | doi = 10.1002/jmv.10500 | pmid = 12966545 }}</ref><ref name="Koren-1985">{{Cita pubblicazione | cognome = Koren | nome = G. | coautori = E. Okon; A. Zlotnick | titolo = Coexistence of Kaposi's sarcoma and chronic lymphocytic leukemia in the same lymph node. | rivista = Acta Haematol | volume = 74 | numero = 4 | pagine = 234-5 | anno = 1985 | pmid = 3939068 }}</ref>,


* [[amiloidosi]] (alcune forme)<ref name="Cagnoli-">{{Cita pubblicazione | cognome = Cagnoli | nome = L. | coautori = | titolo = [Instructions and implementations for percutaneous renal biopsy. Guidelines for the therapy of glomerular nephropaties] | rivista = G Ital Nefrol | volume = 20 Suppl 24 | numero = | pagine = S3-47 | mese = | anno = | doi = | id = PMID 14666502 }}</ref><ref name="Tan-1995">{{Cita pubblicazione | cognome = Tan | nome = SY. | coautori = MB. Pepys; PN. Hawkins | titolo = Treatment of amyloidosis. | rivista = Am J Kidney Dis | volume = 26 | numero = 2 | pagine = 267-85 | mese=agosto| anno = 1995 | doi = | id = PMID 7645531 }}</ref><ref name="Gertz-1994">{{Cita pubblicazione | cognome = Gertz | nome = MA. | coautori = RA. Kyle | titolo = Amyloidosis: prognosis and treatment. | rivista = Semin Arthritis Rheum | volume = 24 | numero = 2 | pagine = 124-38 | mese=ottobre| anno = 1994 | doi = | id = PMID 7839154 }}</ref>,
* [[amiloidosi]] (alcune forme)<ref name="Cagnoli-">{{Cita pubblicazione | cognome = Cagnoli | nome = L. | titolo = [Instructions and implementations for percutaneous renal biopsy. Guidelines for the therapy of glomerular nephropaties] | rivista = G Ital Nefrol | volume = 20 Suppl 24 | pagine = S3-47 | pmid = 14666502 }}</ref><ref name="Tan-1995">{{Cita pubblicazione | cognome = Tan | nome = SY. | coautori = MB. Pepys; PN. Hawkins | titolo = Treatment of amyloidosis. | rivista = Am J Kidney Dis | volume = 26 | numero = 2 | pagine = 267-85 | mese=agosto| anno = 1995 | pmid = 7645531 }}</ref><ref name="Gertz-1994">{{Cita pubblicazione | cognome = Gertz | nome = MA. | coautori = RA. Kyle | titolo = Amyloidosis: prognosis and treatment. | rivista = Semin Arthritis Rheum | volume = 24 | numero = 2 | pagine = 124-38 | mese=ottobre| anno = 1994 | pmid = 7839154 }}</ref>,


* [[granulomatosi di Wegener]]<ref name="Berlit-1996">{{Cita pubblicazione | cognome = Berlit | nome = P. | coautori = | titolo = [Vasculitis] | rivista = Ther Umsch | volume = 53 | numero = 7 | pagine = 559-67 | mese=luglio| anno = 1996 | doi = | id = PMID 8711631 }}</ref><ref name="Ferrari-1993">{{Cita pubblicazione | cognome = Ferrari | nome = P. | coautori = FJ. Frey | titolo = [Immunosuppressive therapy of glomerulonephritis--controlled studies] | rivista = Ther Umsch | volume = 50 | numero = 2 | pagine = 119-29 | mese=febbraio| anno = 1993 | doi = | id = PMID 8456416 }}</ref><ref name="Leavitt-1986">{{Cita pubblicazione | cognome = Leavitt | nome = RY. | coautori = AS. Fauci | titolo = Pulmonary vasculitis. | rivista = Am Rev Respir Dis | volume = 134 | numero = 1 | pagine = 149-66 | mese=luglio| anno = 1986 | doi = | id = PMID 2873770 }}</ref>.
* [[granulomatosi di Wegener]]<ref name="Berlit-1996">{{Cita pubblicazione | cognome = Berlit | nome = P. | titolo = [Vasculitis] | rivista = Ther Umsch | volume = 53 | numero = 7 | pagine = 559-67 | mese=luglio| anno = 1996 | pmid = 8711631 }}</ref><ref name="Ferrari-1993">{{Cita pubblicazione | cognome = Ferrari | nome = P. | coautori = FJ. Frey | titolo = [Immunosuppressive therapy of glomerulonephritis--controlled studies] | rivista = Ther Umsch | volume = 50 | numero = 2 | pagine = 119-29 | mese=febbraio| anno = 1993 | pmid = 8456416 }}</ref><ref name="Leavitt-1986">{{Cita pubblicazione | cognome = Leavitt | nome = RY. | coautori = AS. Fauci | titolo = Pulmonary vasculitis. | rivista = Am Rev Respir Dis | volume = 134 | numero = 1 | pagine = 149-66 | mese=luglio| anno = 1986 | pmid = 2873770 }}</ref>.


==Controindicazioni==
==Controindicazioni==
Riga 112: Riga 112:


== Bibliografia ==
== Bibliografia ==
* {{cita libro | cognome= Romanelli | nome= Paolo | coautori= Kerdel Franciso A, Trent Jennifer T| titolo= Manuale di terapia dermatologica| editore= McGraw-Hill| città= Milano| anno=2006 | id= ISBN 88-386-3913-2}}
* {{cita libro | cognome= Romanelli | nome= Paolo | coautori= Kerdel Franciso A, Trent Jennifer T| titolo= Manuale di terapia dermatologica| editore= McGraw-Hill| città= Milano| anno=2006 | isbn= 88-386-3913-2}}


== Voci correlate ==
== Voci correlate ==

Versione delle 21:34, 28 set 2014

Le informazioni riportate non sono consigli medici e potrebbero non essere accurate. I contenuti hanno solo fine illustrativo e non sostituiscono il parere medico: leggi le avvertenze.
Clorambucile
Nomi alternativi
CB-1348; Chlorambucilum; Chloraminophene; Chlorbutinum; Clorambucilo; NSC-3088; WR-139013
Caratteristiche generali
Formula bruta o molecolareC14H19Cl2N1O2
Massa molecolare (u)304.212 g/mol
Numero CAS305-03-3
Numero EINECS206-162-0
Codice ATCL01AA02
PubChem2708
DrugBankDBAPRD00115
SMILES
C1=CC(=CC=C1CCCC(=O)O)N(CCCl)CCCl
Dati farmacologici
Modalità di
somministrazione		Orale
Dati farmacocinetici
Emivita1,5 ore
Indicazioni di sicurezza
Simboli di rischio chimico
tossico a lungo termine tossicità acuta
pericolo
Frasi H301 - 315 - 319 - 335 - 350
Consigli P201 - 261 - 301+310 - 305+351+338 - 308+313 [1]
Modifica dati su Wikidata · Manuale

Il clorambucile o clorambucil[2] è un agente alchilante, ed è un principio attivo usato in diverse malattie dermatologiche e tumorali.

Come tutti gli agenti alchilanti, determina alterazioni nella sintesi e duplicazione degli acidi nucleici (DNA), determinando la morte cellulare delle stesse cellule per apoptosi dovuta alle estese lesioni nucleari determinate.

In Italia è commercializzato da parte della GSK con il marchio: Leukeran[3]; il marchio è lo stesso in tutto il mondo.

Reattività e caratteristiche chimiche

È una polvere bianca e cristallina. Insolubile in acqua, debolmente solubile in alcool e in acetone; è fotosensibile.

Indicazioni

Le indicazioni approvate dall'RCP sono: Morbo di Hodgkin, alcune forme di linfomi non-Hodgkin, Leucemia linfocita cronica e la Macroglobulinemia di Waldenström.

Off Label

Lo stesso argomento in dettaglio: Off-label.

Viene anche utilizzato in caso di:

Controindicazioni

Da evitare in caso di gravidanza per l'alto rischio potenziale di teratogenicità e in caso ipersensibilità nota al farmaco.

Dosaggi

  • La quantità da somministrare varia da 0,1-0,2 mg/kg/die secondo l'indicazione d'uso; da 2 mg a 16 mg al giorno in caso di Macroglobulinemia di Waldenström.

Effetti indesiderati

Fra gli effetti collaterali più frequenti si riscontrano immunodepressione, anemia, amenorrea, nausea, diarrea, alopecia, vomito, ittero, cistite, neuropatia periferica, atassia, sindrome di Stevens-Johnson.

Interazioni

Vaccini derivati da organismi vivi e fenilbutazone.

Sovradosaggio e potenziale d'abuso

I sintomi da sovradosaggio sono: pancitopenia tossicità neurologica con convulsioni ed atassia. Non esiste alcun antidoto, utili le trasfusioni in caso di sovradosaggio.

Proprietà chimiche e farmacologiche

Farmacocinetica

La biodisponibilità per via orale è buona.

Il metabolismo comporta un'ossidazione della catena dell'acido butirrico della molecola. Il principale metabolita è: l'acido bis- 2.cloroetil-2.(4.aminofenil) acetico o (mostarda dell'acido fenilacetico (PAAM)).

L'escrezione urinaria è bassa.

Farmacodinamica

È una sostanza alchilante derivata dalla mostarda azotata; è in grado di provocare legami a ponte tra le basi nucleotidiche impedendo la normale duplicazione/replicazione del DNA; ciò grazie alla presenza, nella molecola di clorambucile, di un radicale etilammonio che ha altissima reattività chimica.

Formulazioni in commercio

Le formulazioni in commercio del clorambucile sono le compresse da 2 e 5 mg, il nome commerciale è Leukeran e viene commercializzato sin dal 13 ottobre 1982 da parte della GSK.

La sintesi chimica, il brevetto nonché tutti gli studi registrativi sono della: The Wellcome Foundation Ltd azienda che è stata assorbita dalla Glaxo poi diventata GSK.

Note

  1. ^ Sigma Aldrich; rev. del 05.07.2013
  2. ^ Farmacopea Ufficiale della Repubblica Italiana: testi in vigore, su iss.it. URL consultato il 28 luglio 2010.
  3. ^ Leukeran 2mg, su torrinomedica.it. URL consultato l'11 agosto 2010.
  4. ^ EH. Choy, JE. Hoogendijk; B. Lecky; JB. Winer; P. Gordon, WITHDRAWN: Immunosuppressant and immunomodulatory treatment for dermatomyositis and polymyositis., in Cochrane Database Syst Rev, n. 4, 2009, pp. CD003643, DOI:10.1002/14651858.CD003643.pub3, PMID 19821312.
  5. ^ EH. Choy, JE. Hoogendijk; B. Lecky; JB. Winer, Immunosuppressant and immunomodulatory treatment for dermatomyositis and polymyositis., in Cochrane Database Syst Rev, n. 3, 2005, pp. CD003643, DOI:10.1002/14651858.CD003643.pub2, PMID 16034905.
  6. ^ P. Cherin, S. Pelletier; A. Teixeira; P. Laforet; T. Genereau; A. Simon; T. Maisonobe; B. Eymard; S. Herson, Results and long-term followup of intravenous immunoglobulin infusions in chronic, refractory polymyositis: an open study with thirty-five adult patients., in Arthritis Rheum, vol. 46, n. 2, febbraio 2002, pp. 467-74, PMID 11840450.
  7. ^ AJ. Whallett, TJ. Gillott; R. Klocke; JS. Coppock, A case of refractory adult dermatomyositis., in Br J Rheumatol, vol. 37, n. 5, maggio 1998, pp. 544-5, PMID 9651083.
  8. ^ SW. Yeh, N. Sami; RA. Ahmed, Treatment of pemphigus vulgaris: current and emerging options., in Am J Clin Dermatol, vol. 6, n. 5, 2005, pp. 327-42, PMID 16252932.
  9. ^ WS. Rosenkrantz, Pemphigus: current therapy., in Vet Dermatol, vol. 15, n. 2, aprile 2004, pp. 90-8, DOI:10.1111/j.1365-3164.2004.00360.x, PMID 15030557.
  10. ^ N. Shah, AR. Green; GW. Elgart; F. Kerdel, The use of chlorambucil with prednisone in the treatment of pemphigus., in J Am Acad Dermatol, vol. 42, 1 Pt 1, gennaio 2000, pp. 85-8, PMID 10607325.
  11. ^ NC. Cowley, SM. Neill; RC. Staughton, Pemphigus foliaceus and non-Hodgkin's lymphoma., in Int J Dermatol, vol. 33, n. 7, luglio 1994, pp. 510-1, PMID 7928040.
  12. ^ M. Brugiatelli, G. Bandini; G. Barosi; F. Lauria; V. Liso; M. Marchetti; FR. Mauro; G. Meloni; PL. Zinzani; S. Tura, Management of chronic lymphocytic leukemia: practice guidelines from the Italian Society of Hematology, the Italian Society of Experimental Hematology and the Italian Group for Bone Marrow Transplantation., in Haematologica, vol. 91, n. 12, dicembre 2006, pp. 1662-73, PMID 17145603.
  13. ^ M. Steurer, G. Pall; S. Richards; G. Schwarzer; J. Bohlius; R. Greil, Purine antagonists for chronic lymphocytic leukaemia., in Cochrane Database Syst Rev, vol. 3, 2006, pp. CD004270, DOI:10.1002/14651858.CD004270.pub2, PMID 16856041.
  14. ^ A. Atra, E. Higgs; M. Capra; A. Elsworth; J. Imeson; M. Radford; M. Hewitt, ChlVPP chemotherapy in children with stage IV Hodgkin's disease: results of the UKCCSG HD 8201 and HD 9201 studies., in Br J Haematol, vol. 119, n. 3, dicembre 2002, pp. 647-51, PMID 12437639.
  15. ^ Chemotherapeutic options in chronic lymphocytic leukemia: a meta-analysis of the randomized trials. CLL Trialists' Collaborative Group., in J Natl Cancer Inst, vol. 91, n. 10, maggio 1999, pp. 861-8, PMID 10340906.
  16. ^ E. Miot-Noirault, B. Reux; E. Debiton; JC. Madelmont; JM. Chezal; P. Coudert; V. Weber, Preclinical investigation of tolerance and antitumour activity of new fluorodeoxyglucose-coupled chlorambucil alkylating agents., in Invest New Drugs, dicembre 2009, DOI:10.1007/s10637-009-9371-0, PMID 20033262.
  17. ^ CB. Doherty, T. Rosen, Evidence-based therapy for cutaneous sarcoidosis., in Drugs, vol. 68, n. 10, 2008, pp. 1361-83, PMID 18578557.
  18. ^ PL. Zinzani, M. Martelli; V. Poletti; U. Vitolo; PG. Gobbi; T. Chisesi; G. Barosi; AJ. Ferreri; M. Marchetti; N. Pimpinelli; S. Tura, Practice guidelines for the management of extranodal non-Hodgkin's lymphomas of adult non-immunodeficient patients. Part I: primary lung and mediastinal lymphomas. A project of the Italian Society of Hematology, the Italian Society of Experimental Hematology and the Italian Group for Bone Marrow Transplantation., in Haematologica, vol. 93, n. 9, settembre 2008, pp. 1364-71, DOI:10.3324/haematol.12742, PMID 18603558.
  19. ^ BS. Yadav, SC. Sharma; RK. Kapoor, Paraneoplastic leukocytoclastic vasculitis in chronic lymphoid leukemia., in J Cancer Res Ther, vol. 2, n. 4, pp. 206-8, PMID 17998707.
  20. ^ M. van Agthoven, MH. Kramer; P. Sonneveld; KG. van der Hem; PC. Huijgens; PW. Wijermans; HC. Kluin-Nelemans; MR. Schaafsma; DH. Biesma; V. Mattijssen; CA. Uyl-de Groot, Cost analysis of common treatment options for indolent follicular non-Hodgkin's lymphoma., in Haematologica, vol. 90, n. 10, ottobre 2005, pp. 1422-32, PMID 16219580.
  21. ^ M. Sieber, H. Tesch; B. Pfistner; U. Rueffer; U. Paulus; R. Munker; R. Hermann; G. Doelken; P. Koch; J. Oertel; S. Roller, Treatment of advanced Hodgkin's disease with COPP/ABV/IMEP versus COPP/ABVD and consolidating radiotherapy: final results of the German Hodgkin's Lymphoma Study Group HD6 trial., in Ann Oncol, vol. 15, n. 2, febbraio 2004, pp. 276-82, PMID 14760122.
  22. ^ C. Metayer, RE. Curtis; J. Vose; KA. Sobocinski; MM. Horowitz; S. Bhatia; JW. Fay; CO. Freytes; SC. Goldstein; RH. Herzig; A. Keating, Myelodysplastic syndrome and acute myeloid leukemia after autotransplantation for lymphoma: a multicenter case-control study., in Blood, vol. 101, n. 5, marzo 2003, pp. 2015-23, DOI:10.1182/blood-2002-04-1261, PMID 12393427.
  23. ^ TE. Witzig, M. Timm; M. Stenson; PA. Svingen; SH. Kaufmann, Induction of apoptosis in malignant B cells by phenylbutyrate or phenylacetate in combination with chemotherapeutic agents., in Clin Cancer Res, vol. 6, n. 2, febbraio 2000, pp. 681-92, PMID 10690554.
  24. ^ JM. Zaghetto, MM. Yamamoto; MB. Souza; FT. Silva; CE. Hirata; E. Olivalves; JH. Yamamoto, Chlorambucil and cyclosporine A in Brazilian patients with Behçet's disease uveitis: a retrospective study., in Arq Bras Oftalmol, vol. 73, n. 1, febbraio 2010, pp. 40-6, PMID 20464112.
  25. ^ A. Borhani Haghighi, Treatment of neuro-Behçet's disease: an update., in Expert Rev Neurother, vol. 9, n. 4, aprile 2009, pp. 565-74, DOI:10.1586/ern.09.11, PMID 19344307.
  26. ^ AN. Santana, T. Antunes; JM. Barros; RA. Kairalla; CR. Carvalho; CS. Barbas, [Pulmonary involvement in Behcet's disease: a positive single-center experience with the use of immunosuppressive therapy], in J Bras Pneumol, vol. 34, n. 6, giugno 2008, pp. 362-6, PMID 18622502.
  27. ^ A. Vidaller Palacín, J. Robert Olalla; B. Sanuy Jiménez; G. Rufi Rigau; J. Folch Civit; A. Charte González, [Behcet's disease therapy review], in An Med Interna, vol. 19, n. 11, novembre 2002, pp. 594-8, PMID 12522899.
  28. ^ AI. Russell, WA. Lawson; DO. Haskard, Potential new therapeutic options in Behçet's syndrome., in BioDrugs, vol. 15, n. 1, 2001, pp. 25-35, PMID 11437673.
  29. ^ WJ. Dinning, ES. Perkins, Immunosuppressives in uveitis. A preliminary report of experience with chlorambucil., in Br J Ophthalmol, vol. 59, n. 8, agosto 1975, pp. 397-403, PMID 1081881.
  30. ^ SR. Vavricka, J. Halter; L. Hechelhammer; A. Himmelmann, Pneumocystis carinii pneumonia in chronic lymphocytic leukaemia., in Postgrad Med J, vol. 80, n. 942, aprile 2004, pp. 236-8, PMID 15082848.
  31. ^ B. Kamran, M. Fatemeh; R. Ahmadreza; N. Azita, Bullous mycosis fungoides: a case report., in Dermatol Online J, vol. 14, n. 2, 2008, p. 11, PMID 18700114.
  32. ^ W. Marder, WJ. McCune, Advances in immunosuppressive therapy., in Semin Respir Crit Care Med, vol. 28, n. 4, agosto 2007, pp. 398-417, DOI:10.1055/s-2007-985612, PMID 17764058.
  33. ^ E. Wielosz, M. Majdan; D. Suszek; I. Smarz-Widelska; A. Korolczuk; E. Korobowicz, Nephrotic syndrome as a clinical manifestation of systemic sclerosis., in Rheumatol Int, vol. 27, n. 11, settembre 2007, pp. 1087-9, DOI:10.1007/s00296-007-0340-7, PMID 17429639.
  34. ^ P. Clements, P. Lachenbruch; D. Furst; H. Paulus, The course of skin involvement in systemic sclerosis over three years in a trial of chlorambucil versus placebo., in Arthritis Rheum, vol. 36, n. 11, novembre 1993, pp. 1575-9, PMID 8240434.
  35. ^ BM. Ansell, GA. Nasseh; EG. Bywaters, Scleroderma in childhood., in Ann Rheum Dis, vol. 35, n. 3, giugno 1976, pp. 189-97, PMID 984898.
  36. ^ I. Azais, G. Lambert de Cursay; F. Deblais; O. Deschamps; P. Gandon; M. Alcalay; D. Bontoux, [Association of rheumatoid arthritis and Kaposi disease. Apropos of a case arising after intraarticular corticotherapy], in Rev Rhum Ed Fr, vol. 60, n. 3, marzo 1993, pp. 240-4, PMID 8293010.
  37. ^ S. Senanayake, J. Kelly; A. Lloyd; Z. Waliuzzaman; D. Goldstein; W. Rawlinson, Multicentric Castleman's disease treated with antivirals and immunosuppressants., in J Med Virol, vol. 71, n. 3, novembre 2003, pp. 399-403, DOI:10.1002/jmv.10500, PMID 12966545.
  38. ^ G. Koren, E. Okon; A. Zlotnick, Coexistence of Kaposi's sarcoma and chronic lymphocytic leukemia in the same lymph node., in Acta Haematol, vol. 74, n. 4, 1985, pp. 234-5, PMID 3939068.
  39. ^ L. Cagnoli, [Instructions and implementations for percutaneous renal biopsy. Guidelines for the therapy of glomerular nephropaties], in G Ital Nefrol, 20 Suppl 24, pp. S3-47, PMID 14666502.
  40. ^ SY. Tan, MB. Pepys; PN. Hawkins, Treatment of amyloidosis., in Am J Kidney Dis, vol. 26, n. 2, agosto 1995, pp. 267-85, PMID 7645531.
  41. ^ MA. Gertz, RA. Kyle, Amyloidosis: prognosis and treatment., in Semin Arthritis Rheum, vol. 24, n. 2, ottobre 1994, pp. 124-38, PMID 7839154.
  42. ^ P. Berlit, [Vasculitis], in Ther Umsch, vol. 53, n. 7, luglio 1996, pp. 559-67, PMID 8711631.
  43. ^ P. Ferrari, FJ. Frey, [Immunosuppressive therapy of glomerulonephritis--controlled studies], in Ther Umsch, vol. 50, n. 2, febbraio 1993, pp. 119-29, PMID 8456416.
  44. ^ RY. Leavitt, AS. Fauci, Pulmonary vasculitis., in Am Rev Respir Dis, vol. 134, n. 1, luglio 1986, pp. 149-66, PMID 2873770.

Bibliografia

  • Paolo Romanelli, Kerdel Franciso A, Trent Jennifer T, Manuale di terapia dermatologica, Milano, McGraw-Hill, 2006, ISBN 88-386-3913-2.

Voci correlate

Collegamenti esterni

  Portale Medicina: accedi alle voci di Wikipedia che trattano di medicina
Estratto da "https://it.wikipedia.org/w/index.php?title=Clorambucile&oldid=68379241"