Acido argininsuccinico

Da Wikipedia, l'enciclopedia libera.
Acido argininsuccinico
Argininosuccinic acid.svg
Zwitterione
Caratteristiche generali
Formula bruta o molecolareC10H18N4O6
Massa molecolare (u)290,27312
Numero CAS2387-71-5
PubChem16950
DrugBankDB02267
SMILES
C(CC(C(=O)O)N)CN=C(N)NC(CC(=O)O)C(=O)O
Indicazioni di sicurezza

L'acido argininsuccinico è un composto intermedio del ciclo dell'urea, che si forma per condensazione della citrullina con l'aspartato in una reazione catalizzata dall'enzima argininosuccinato sintetasi.

ATP + citrullina + aspartato = AMP + PPi + argininsuccinato
Chimica Portale Chimica: il portale della scienza della composizione, delle proprietà e delle trasformazioni della materia