Xantotossolo

Da Wikipedia, l'enciclopedia libera.
Xantotossolo
Xanthotoxol.png
Nomi alternativi
8-idrossipsoralene
Caratteristiche generali
Formula bruta o molecolare C11H6O4
Massa molecolare (u) 202,17
Numero CAS 2009-24-7
PubChem 65090
SMILES C1=CC(=O)OC2=C(C3=C(C=CO3)C=C21)O

Lo xantotossolo è una sostanza organica naturale appartenente alla famiglia delle furanocumarine lineari, prodotta come difesa da alcune piante.

chimica Portale Chimica: il portale della scienza della composizione, delle proprietà e delle trasformazioni della materia